About 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid
6-(1,1-difluoroethyl)pyridine-2-carboxylic acid (PubChem CID 84719052) has the molecular formula C8H7F2NO2
and a molecular weight of 187.15 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid |
| PubChem CID | 84719052 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid |
| SMILES | CC(F)(F)c1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C8H7F2NO2/c1-8(9,10)6-4-2-3-5(11-6)7(12)13/h2-4H,1H3,(H,12,13) |
| InChIKey | RSIRTUDFDFJYAW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid (CID 84719052) is 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid is CC(F)(F)c1cccc(C(=O)O)n1.
What is the InChIKey of 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid?
The InChIKey is RSIRTUDFDFJYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO2/c1-8(9,10)6-4-2-3-5(11-6)7(12)13/h2-4H,1H3,(H,12,13).
What are the key properties of 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid?
6-(1,1-difluoroethyl)pyridine-2-carboxylic acid has a molecular weight of 187.15 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 84719052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).