C12H15FO — CID 84720329
1-[(1-fluorocyclobutyl)methyl]-3-methoxybenzene (PubChem CID 84720329) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-[(1-fluorocyclobutyl)methyl]-3-methoxybenzene.
| Compound Name | 1-[(1-fluorocyclobutyl)methyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 84720329 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-[(1-fluorocyclobutyl)methyl]-3-methoxybenzene |
| SMILES | COc1cccc(CC2(F)CCC2)c1 |
| InChI | InChI=1S/C12H15FO/c1-14-11-5-2-4-10(8-11)9-12(13)6-3-7-12/h2,4-5,8H,3,6-7,9H2,1H3 |
| InChIKey | WWOSVHTTWDMEPP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |