About 5-(4-fluorophenyl)-1,3-oxazinan-2-one
5-(4-fluorophenyl)-1,3-oxazinan-2-one (PubChem CID 84720416) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-1,3-oxazinan-2-one |
| PubChem CID | 84720416 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 5-(4-fluorophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1NCC(c2ccc(F)cc2)CO1 |
| InChI | InChI=1S/C10H10FNO2/c11-9-3-1-7(2-4-9)8-5-12-10(13)14-6-8/h1-4,8H,5-6H2,(H,12,13) |
| InChIKey | BGDPILZMKUNOQC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-fluorophenyl)-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-1,3-oxazinan-2-one?
The IUPAC name of 5-(4-fluorophenyl)-1,3-oxazinan-2-one (CID 84720416) is 5-(4-fluorophenyl)-1,3-oxazinan-2-one.
What is the SMILES notation for 5-(4-fluorophenyl)-1,3-oxazinan-2-one?
The canonical SMILES for 5-(4-fluorophenyl)-1,3-oxazinan-2-one is O=C1NCC(c2ccc(F)cc2)CO1.
What is the InChIKey of 5-(4-fluorophenyl)-1,3-oxazinan-2-one?
The InChIKey is BGDPILZMKUNOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c11-9-3-1-7(2-4-9)8-5-12-10(13)14-6-8/h1-4,8H,5-6H2,(H,12,13).
What are the key properties of 5-(4-fluorophenyl)-1,3-oxazinan-2-one?
5-(4-fluorophenyl)-1,3-oxazinan-2-one has a molecular weight of 195.19 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-1,3-oxazinan-2-one is sourced from PubChem (CID 84720416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).