About 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine
2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (PubChem CID 84720759) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
| PubChem CID | 84720759 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
| SMILES | c1ccc(-c2ccc3c(n2)CNC3)cc1 |
| InChI | InChI=1S/C13H12N2/c1-2-4-10(5-3-1)12-7-6-11-8-14-9-13(11)15-12/h1-7,14H,8-9H2 |
| InChIKey | PLTRLHHLLGBLQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The IUPAC name of 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (CID 84720759) is 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine.
What is the SMILES notation for 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The canonical SMILES for 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is c1ccc(-c2ccc3c(n2)CNC3)cc1.
What is the InChIKey of 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The InChIKey is PLTRLHHLLGBLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-4-10(5-3-1)12-7-6-11-8-14-9-13(11)15-12/h1-7,14H,8-9H2.
What are the key properties of 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine has a molecular weight of 196.25 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is sourced from PubChem (CID 84720759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).