About 2-(3,3-difluoropyrrolidin-2-yl)phenol
2-(3,3-difluoropyrrolidin-2-yl)phenol (PubChem CID 84721047) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(3,3-difluoropyrrolidin-2-yl)phenol |
| PubChem CID | 84721047 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-2-yl)phenol |
| SMILES | Oc1ccccc1C1NCCC1(F)F |
| InChI | InChI=1S/C10H11F2NO/c11-10(12)5-6-13-9(10)7-3-1-2-4-8(7)14/h1-4,9,13-14H,5-6H2 |
| InChIKey | BAWJFNXIMONEOF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-difluoropyrrolidin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropyrrolidin-2-yl)phenol?
The IUPAC name of 2-(3,3-difluoropyrrolidin-2-yl)phenol (CID 84721047) is 2-(3,3-difluoropyrrolidin-2-yl)phenol.
What is the SMILES notation for 2-(3,3-difluoropyrrolidin-2-yl)phenol?
The canonical SMILES for 2-(3,3-difluoropyrrolidin-2-yl)phenol is Oc1ccccc1C1NCCC1(F)F.
What is the InChIKey of 2-(3,3-difluoropyrrolidin-2-yl)phenol?
The InChIKey is BAWJFNXIMONEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO/c11-10(12)5-6-13-9(10)7-3-1-2-4-8(7)14/h1-4,9,13-14H,5-6H2.
What are the key properties of 2-(3,3-difluoropyrrolidin-2-yl)phenol?
2-(3,3-difluoropyrrolidin-2-yl)phenol has a molecular weight of 199.20 g/mol, XLogP of 2.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropyrrolidin-2-yl)phenol is sourced from PubChem (CID 84721047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).