About 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one
2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 84721818) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
| PubChem CID | 84721818 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(CC2N)c2cccc(O)c21 |
| InChI | InChI=1S/C11H12N2O2/c1-13-9-6(3-2-4-7(9)14)11(10(13)15)5-8(11)12/h2-4,8,14H,5,12H2,1H3 |
| InChIKey | XEWMMRQISBYFPR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
The IUPAC name of 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one (CID 84721818) is 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one.
What is the SMILES notation for 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
The canonical SMILES for 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one is CN1C(=O)C2(CC2N)c2cccc(O)c21.
What is the InChIKey of 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
The InChIKey is XEWMMRQISBYFPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-13-9-6(3-2-4-7(9)14)11(10(13)15)5-8(11)12/h2-4,8,14H,5,12H2,1H3.
What are the key properties of 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one?
2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one has a molecular weight of 204.23 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7'-hydroxy-1'-methylspiro[cyclopropane-1,3'-indole]-2'-one is sourced from PubChem (CID 84721818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).