4,4-difluoro-2-methylbutane-1-sulfonyl chloride

C5H9ClF2O2S — CID 84722343

IUPAC4,4-difluoro-2-methylbutane-1-sulfonyl chloride
SMILESCC(CC(F)F)CS(=O)(=O)Cl
InChIInChI=1S/C5H9ClF2O2S/c1-4(2-5(7)8)3-11(6,9)10/h4-5H,2-3H2,1H3
InChIKeyJRZSMGCNAWRVAQ-UHFFFAOYSA-N
MW206.64 g/mol
LogP1.85
Rot. Bonds4

About 4,4-difluoro-2-methylbutane-1-sulfonyl chloride

4,4-difluoro-2-methylbutane-1-sulfonyl chloride (PubChem CID 84722343) has the molecular formula C5H9ClF2O2S and a molecular weight of 206.64 g/mol. Its IUPAC name is 4,4-difluoro-2-methylbutane-1-sulfonyl chloride.

Molecular Properties

Compound Name4,4-difluoro-2-methylbutane-1-sulfonyl chloride
PubChem CID84722343
Molecular FormulaC5H9ClF2O2S
Molecular Weight206.64 g/mol
Exact Mass206.00
IUPAC Name4,4-difluoro-2-methylbutane-1-sulfonyl chloride
SMILESCC(CC(F)F)CS(=O)(=O)Cl
InChIInChI=1S/C5H9ClF2O2S/c1-4(2-5(7)8)3-11(6,9)10/h4-5H,2-3H2,1H3
InChIKeyJRZSMGCNAWRVAQ-UHFFFAOYSA-N
XLogP1.85
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.64
LogP ≤ 51.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 4,4-difluoro-2-methylbutane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-Methylbutane-1-sulfonyl chloride
CID 12933327
2-Methylbutane-1-sulfonyl chloride
CID 20532502
3-Methylbutane-2-sulfonyl chloride
CID 21354490
3,3-Difluorobutane-1-sulfonyl chloride
CID 84664403
3,3,3-Trifluoro-2-methylpropane-1-sulfonyl chloride
CID 84723207
2,2-Difluorobutane-1-sulfonyl chloride
CID 105446602
2-Fluoro-2-methylpropane-1-sulfonyl chloride
CID 126688674
3,3-Difluoro-2,2-dimethylpropane-1-sulfonyl chloride
CID 84674725
4,4,4-Trifluoro-2-methylbutane-1-sulfonyl chloride
CID 84725559
3,3,3-Trifluoro-2,2-dimethylpropane-1-sulfonyl chloride
CID 84725562
4,4,4-Trifluoro-2,2-dimethylbutane-1-sulfonyl chloride
CID 84727799
4,4,4-Trifluoro-3,3-dimethylbutane-1-sulfonyl chloride
CID 84727800

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-2-methylbutane-1-sulfonyl chloride?
The IUPAC name of 4,4-difluoro-2-methylbutane-1-sulfonyl chloride (CID 84722343) is 4,4-difluoro-2-methylbutane-1-sulfonyl chloride.
What is the SMILES notation for 4,4-difluoro-2-methylbutane-1-sulfonyl chloride?
The canonical SMILES for 4,4-difluoro-2-methylbutane-1-sulfonyl chloride is CC(CC(F)F)CS(=O)(=O)Cl.
What is the InChIKey of 4,4-difluoro-2-methylbutane-1-sulfonyl chloride?
The InChIKey is JRZSMGCNAWRVAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClF2O2S/c1-4(2-5(7)8)3-11(6,9)10/h4-5H,2-3H2,1H3.
What are the key properties of 4,4-difluoro-2-methylbutane-1-sulfonyl chloride?
4,4-difluoro-2-methylbutane-1-sulfonyl chloride has a molecular weight of 206.64 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-2-methylbutane-1-sulfonyl chloride is sourced from PubChem (CID 84722343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).