C13H18FN — CID 84722501
2-[1-fluoro-1-(3-methylphenyl)ethyl]pyrrolidine (PubChem CID 84722501) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-[1-fluoro-1-(3-methylphenyl)ethyl]pyrrolidine.
| Compound Name | 2-[1-fluoro-1-(3-methylphenyl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 84722501 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-[1-fluoro-1-(3-methylphenyl)ethyl]pyrrolidine |
| SMILES | Cc1cccc(C(C)(F)C2CCCN2)c1 |
| InChI | InChI=1S/C13H18FN/c1-10-5-3-6-11(9-10)13(2,14)12-7-4-8-15-12/h3,5-6,9,12,15H,4,7-8H2,1-2H3 |
| InChIKey | BAHZVEBAFFULOQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |