About 4-benzyl-4-fluorothiane
4-benzyl-4-fluorothiane (PubChem CID 84723196) has the molecular formula C12H15FS
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-benzyl-4-fluorothiane.
Molecular Properties
| Compound Name | 4-benzyl-4-fluorothiane |
| PubChem CID | 84723196 |
| Molecular Formula | C12H15FS |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4-benzyl-4-fluorothiane |
| SMILES | FC1(Cc2ccccc2)CCSCC1 |
| InChI | InChI=1S/C12H15FS/c13-12(6-8-14-9-7-12)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | KFDBQDUEOMJFDF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-4-fluorothiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-4-fluorothiane?
The IUPAC name of 4-benzyl-4-fluorothiane (CID 84723196) is 4-benzyl-4-fluorothiane.
What is the SMILES notation for 4-benzyl-4-fluorothiane?
The canonical SMILES for 4-benzyl-4-fluorothiane is FC1(Cc2ccccc2)CCSCC1.
What is the InChIKey of 4-benzyl-4-fluorothiane?
The InChIKey is KFDBQDUEOMJFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FS/c13-12(6-8-14-9-7-12)10-11-4-2-1-3-5-11/h1-5H,6-10H2.
What are the key properties of 4-benzyl-4-fluorothiane?
4-benzyl-4-fluorothiane has a molecular weight of 210.32 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-4-fluorothiane is sourced from PubChem (CID 84723196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).