About dimethyl 2-(2,2,2-trifluoroethyl)propanedioate
dimethyl 2-(2,2,2-trifluoroethyl)propanedioate (PubChem CID 84723618) has the molecular formula C7H9F3O4
and a molecular weight of 214.14 g/mol. Its IUPAC name is dimethyl 2-(2,2,2-trifluoroethyl)propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-(2,2,2-trifluoroethyl)propanedioate |
| PubChem CID | 84723618 |
| Molecular Formula | C7H9F3O4 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | dimethyl 2-(2,2,2-trifluoroethyl)propanedioate |
| SMILES | COC(=O)C(CC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C7H9F3O4/c1-13-5(11)4(6(12)14-2)3-7(8,9)10/h4H,3H2,1-2H3 |
| InChIKey | SDSHSYNWKQWBCV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(2,2,2-trifluoroethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(2,2,2-trifluoroethyl)propanedioate?
The IUPAC name of dimethyl 2-(2,2,2-trifluoroethyl)propanedioate (CID 84723618) is dimethyl 2-(2,2,2-trifluoroethyl)propanedioate.
What is the SMILES notation for dimethyl 2-(2,2,2-trifluoroethyl)propanedioate?
The canonical SMILES for dimethyl 2-(2,2,2-trifluoroethyl)propanedioate is COC(=O)C(CC(F)(F)F)C(=O)OC.
What is the InChIKey of dimethyl 2-(2,2,2-trifluoroethyl)propanedioate?
The InChIKey is SDSHSYNWKQWBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3O4/c1-13-5(11)4(6(12)14-2)3-7(8,9)10/h4H,3H2,1-2H3.
What are the key properties of dimethyl 2-(2,2,2-trifluoroethyl)propanedioate?
dimethyl 2-(2,2,2-trifluoroethyl)propanedioate has a molecular weight of 214.14 g/mol, XLogP of 0.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(2,2,2-trifluoroethyl)propanedioate is sourced from PubChem (CID 84723618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).