About 2-amino-N-(1,3-thiazol-2-yl)benzamide
2-amino-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 847246) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-amino-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-amino-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 847246 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-amino-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Nc1ccccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C10H9N3OS/c11-8-4-2-1-3-7(8)9(14)13-10-12-5-6-15-10/h1-6H,11H2,(H,12,13,14) |
| InChIKey | DVXPHPFMFVWGJV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 2-amino-N-(1,3-thiazol-2-yl)benzamide (CID 847246) is 2-amino-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 2-amino-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 2-amino-N-(1,3-thiazol-2-yl)benzamide is Nc1ccccc1C(=O)Nc1nccs1.
What is the InChIKey of 2-amino-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is DVXPHPFMFVWGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c11-8-4-2-1-3-7(8)9(14)13-10-12-5-6-15-10/h1-6H,11H2,(H,12,13,14).
What are the key properties of 2-amino-N-(1,3-thiazol-2-yl)benzamide?
2-amino-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 219.27 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 847246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).