C10H11F4N — CID 84724736
2-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanamine (PubChem CID 84724736) has the molecular formula C10H11F4N and a molecular weight of 221.20 g/mol. Its IUPAC name is 2-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanamine.
| Compound Name | 2-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 84724736 |
| Molecular Formula | C10H11F4N |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-[4-(1,1,2,2-tetrafluoroethyl)phenyl]ethanamine |
| SMILES | NCCc1ccc(C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H11F4N/c11-9(12)10(13,14)8-3-1-7(2-4-8)5-6-15/h1-4,9H,5-6,15H2 |
| InChIKey | XZYNVKQTKQMWPL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|