4-bromo-2-methoxycarbonylbutanoic acid

C6H9BrO4 — CID 84725637

IUPAC4-bromo-2-methoxycarbonylbutanoic acid
SMILESCOC(=O)C(CCBr)C(=O)O
InChIInChI=1S/C6H9BrO4/c1-11-6(10)4(2-3-7)5(8)9/h4H,2-3H2,1H3,(H,8,9)
InChIKeyOFPYVIXBGWOWLI-UHFFFAOYSA-N
MW225.04 g/mol
LogP0.65
Rot. Bonds4

About 4-bromo-2-methoxycarbonylbutanoic acid

4-bromo-2-methoxycarbonylbutanoic acid (PubChem CID 84725637) has the molecular formula C6H9BrO4 and a molecular weight of 225.04 g/mol. Its IUPAC name is 4-bromo-2-methoxycarbonylbutanoic acid.

Molecular Properties

Compound Name4-bromo-2-methoxycarbonylbutanoic acid
PubChem CID84725637
Molecular FormulaC6H9BrO4
Molecular Weight225.04 g/mol
Exact Mass223.97
IUPAC Name4-bromo-2-methoxycarbonylbutanoic acid
SMILESCOC(=O)C(CCBr)C(=O)O
InChIInChI=1S/C6H9BrO4/c1-11-6(10)4(2-3-7)5(8)9/h4H,2-3H2,1H3,(H,8,9)
InChIKeyOFPYVIXBGWOWLI-UHFFFAOYSA-N
XLogP0.65
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.04
LogP ≤ 50.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-bromo-2-methoxycarbonylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2-methoxycarbonylbutanoic acid?
The IUPAC name of 4-bromo-2-methoxycarbonylbutanoic acid (CID 84725637) is 4-bromo-2-methoxycarbonylbutanoic acid.
What is the SMILES notation for 4-bromo-2-methoxycarbonylbutanoic acid?
The canonical SMILES for 4-bromo-2-methoxycarbonylbutanoic acid is COC(=O)C(CCBr)C(=O)O.
What is the InChIKey of 4-bromo-2-methoxycarbonylbutanoic acid?
The InChIKey is OFPYVIXBGWOWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO4/c1-11-6(10)4(2-3-7)5(8)9/h4H,2-3H2,1H3,(H,8,9).
What are the key properties of 4-bromo-2-methoxycarbonylbutanoic acid?
4-bromo-2-methoxycarbonylbutanoic acid has a molecular weight of 225.04 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methoxycarbonylbutanoic acid is sourced from PubChem (CID 84725637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).