About 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine
6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine (PubChem CID 84725752) has the molecular formula C8H8BrN3
and a molecular weight of 226.08 g/mol. Its IUPAC name is 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine |
| PubChem CID | 84725752 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine |
| SMILES | Cc1nn(C)c2cc(Br)cnc12 |
| InChI | InChI=1S/C8H8BrN3/c1-5-8-7(12(2)11-5)3-6(9)4-10-8/h3-4H,1-2H3 |
| InChIKey | HOGKPEUPMSQGIA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine?
The IUPAC name of 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine (CID 84725752) is 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine.
What is the SMILES notation for 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine?
The canonical SMILES for 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine is Cc1nn(C)c2cc(Br)cnc12.
What is the InChIKey of 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine?
The InChIKey is HOGKPEUPMSQGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3/c1-5-8-7(12(2)11-5)3-6(9)4-10-8/h3-4H,1-2H3.
What are the key properties of 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine?
6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine has a molecular weight of 226.08 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-dimethylpyrazolo[4,5-b]pyridine is sourced from PubChem (CID 84725752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).