C15H22FN — CID 84727157
3-[3-[(1-fluorocyclobutyl)methyl]phenyl]-N-methylpropan-1-amine (PubChem CID 84727157) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-[3-[(1-fluorocyclobutyl)methyl]phenyl]-N-methylpropan-1-amine.
| Compound Name | 3-[3-[(1-fluorocyclobutyl)methyl]phenyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 84727157 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3-[3-[(1-fluorocyclobutyl)methyl]phenyl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1cccc(CC2(F)CCC2)c1 |
| InChI | InChI=1S/C15H22FN/c1-17-10-3-7-13-5-2-6-14(11-13)12-15(16)8-4-9-15/h2,5-6,11,17H,3-4,7-10,12H2,1H3 |
| InChIKey | UYXMHGMYWKQIBW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|