C9H10N4O2S — CID 84727720
5-methyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-amine (PubChem CID 84727720) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is 5-methyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-amine.
| Compound Name | 5-methyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 84727720 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 5-methyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-amine |
| SMILES | Cc1cc(N)nc2nc(S(C)(=O)=O)ncc12 |
| InChI | InChI=1S/C9H10N4O2S/c1-5-3-7(10)12-8-6(5)4-11-9(13-8)16(2,14)15/h3-4H,1-2H3,(H2,10,11,12,13) |
| InChIKey | QMGIOVTYJTZRQN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |