About tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate
tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate (PubChem CID 84728230) has the molecular formula C9H17F3N2O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate |
| PubChem CID | 84728230 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(CN)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-8(2,3)16-7(15)14-5-6(4-13)9(10,11)12/h6H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | IYVOWDZHVOJAMV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate?
The IUPAC name of tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate (CID 84728230) is tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate?
The canonical SMILES for tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate is CC(C)(C)OC(=O)NCC(CN)C(F)(F)F.
What is the InChIKey of tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate?
The InChIKey is IYVOWDZHVOJAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2/c1-8(2,3)16-7(15)14-5-6(4-13)9(10,11)12/h6H,4-5,13H2,1-3H3,(H,14,15).
What are the key properties of tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate?
tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate has a molecular weight of 242.24 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(aminomethyl)-3,3,3-trifluoropropyl]carbamate is sourced from PubChem (CID 84728230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).