C10H11BrFN — CID 84728359
7-bromo-5-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 84728359) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 7-bromo-5-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-bromo-5-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 84728359 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 7-bromo-5-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | FC1CNCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H11BrFN/c11-8-2-1-7-3-4-13-6-10(12)9(7)5-8/h1-2,5,10,13H,3-4,6H2 |
| InChIKey | SGHLZUBXKJXBMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |