About 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene
5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene (PubChem CID 84728489) has the molecular formula C10H10BrFO
and a molecular weight of 245.09 g/mol. Its IUPAC name is 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene.
Molecular Properties
| Compound Name | 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene |
| PubChem CID | 84728489 |
| Molecular Formula | C10H10BrFO |
| Molecular Weight | 245.09 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene |
| SMILES | CC1(F)CCOc2cccc(Br)c21 |
| InChI | InChI=1S/C10H10BrFO/c1-10(12)5-6-13-8-4-2-3-7(11)9(8)10/h2-4H,5-6H2,1H3 |
| InChIKey | FZOWYWVVGYIDHL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.09 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene?
The IUPAC name of 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene (CID 84728489) is 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene.
What is the SMILES notation for 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene?
The canonical SMILES for 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene is CC1(F)CCOc2cccc(Br)c21.
What is the InChIKey of 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene?
The InChIKey is FZOWYWVVGYIDHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrFO/c1-10(12)5-6-13-8-4-2-3-7(11)9(8)10/h2-4H,5-6H2,1H3.
What are the key properties of 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene?
5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene has a molecular weight of 245.09 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-fluoro-4-methyl-2,3-dihydrochromene is sourced from PubChem (CID 84728489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).