C12H16BrN — CID 84729224
9-bromo-3,3-dimethyl-1,2,4,5-tetrahydro-1-benzazepine (PubChem CID 84729224) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is 9-bromo-3,3-dimethyl-1,2,4,5-tetrahydro-1-benzazepine.
| Compound Name | 9-bromo-3,3-dimethyl-1,2,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 84729224 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 9-bromo-3,3-dimethyl-1,2,4,5-tetrahydro-1-benzazepine |
| SMILES | CC1(C)CCc2cccc(Br)c2NC1 |
| InChI | InChI=1S/C12H16BrN/c1-12(2)7-6-9-4-3-5-10(13)11(9)14-8-12/h3-5,14H,6-8H2,1-2H3 |
| InChIKey | NFSRLXRSULQGCE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |