About 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one
3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one (PubChem CID 84732174) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one |
| PubChem CID | 84732174 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one |
| SMILES | CCC1NC(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FNO/c1-2-9-8-5-6(11)3-4-7(8)10(13)12-9/h3-5,9H,2H2,1H3,(H,12,13) |
| InChIKey | MYPOLPIHOSMMNC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one (CID 84732174) is 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one is CCC1NC(=O)c2ccc(F)cc21.
What is the InChIKey of 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one?
The InChIKey is MYPOLPIHOSMMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c1-2-9-8-5-6(11)3-4-7(8)10(13)12-9/h3-5,9H,2H2,1H3,(H,12,13).
What are the key properties of 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one?
3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one has a molecular weight of 179.19 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-fluoro-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 84732174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).