About 2-(4,4-difluorocyclohexyl)pyrazol-3-amine
2-(4,4-difluorocyclohexyl)pyrazol-3-amine (PubChem CID 84733810) has the molecular formula C9H13F2N3
and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)pyrazol-3-amine |
| PubChem CID | 84733810 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)pyrazol-3-amine |
| SMILES | Nc1ccnn1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H13F2N3/c10-9(11)4-1-7(2-5-9)14-8(12)3-6-13-14/h3,6-7H,1-2,4-5,12H2 |
| InChIKey | ATPOZYGLWWWOMS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-difluorocyclohexyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)pyrazol-3-amine?
The IUPAC name of 2-(4,4-difluorocyclohexyl)pyrazol-3-amine (CID 84733810) is 2-(4,4-difluorocyclohexyl)pyrazol-3-amine.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)pyrazol-3-amine?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)pyrazol-3-amine is Nc1ccnn1C1CCC(F)(F)CC1.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)pyrazol-3-amine?
The InChIKey is ATPOZYGLWWWOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3/c10-9(11)4-1-7(2-5-9)14-8(12)3-6-13-14/h3,6-7H,1-2,4-5,12H2.
What are the key properties of 2-(4,4-difluorocyclohexyl)pyrazol-3-amine?
2-(4,4-difluorocyclohexyl)pyrazol-3-amine has a molecular weight of 201.22 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)pyrazol-3-amine is sourced from PubChem (CID 84733810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).