About [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine
[2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine (PubChem CID 84733816) has the molecular formula C9H13F2N3
and a molecular weight of 201.22 g/mol. Its IUPAC name is [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine |
| PubChem CID | 84733816 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine |
| SMILES | NCc1ccnn1C1CCCC1(F)F |
| InChI | InChI=1S/C9H13F2N3/c10-9(11)4-1-2-8(9)14-7(6-12)3-5-13-14/h3,5,8H,1-2,4,6,12H2 |
| InChIKey | CLGHQCYBQUMCRP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine?
The IUPAC name of [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine (CID 84733816) is [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine.
What is the SMILES notation for [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine?
The canonical SMILES for [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine is NCc1ccnn1C1CCCC1(F)F.
What is the InChIKey of [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine?
The InChIKey is CLGHQCYBQUMCRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3/c10-9(11)4-1-2-8(9)14-7(6-12)3-5-13-14/h3,5,8H,1-2,4,6,12H2.
What are the key properties of [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine?
[2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine has a molecular weight of 201.22 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-difluorocyclopentyl)pyrazol-3-yl]methanamine is sourced from PubChem (CID 84733816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).