About 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one
3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one (PubChem CID 84735172) has the molecular formula C13H14FNO
and a molecular weight of 219.26 g/mol. Its IUPAC name is 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one |
| PubChem CID | 84735172 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(C2CCCC2)c2c(F)cccc21 |
| InChI | InChI=1S/C13H14FNO/c14-10-7-3-6-9-11(10)12(15-13(9)16)8-4-1-2-5-8/h3,6-8,12H,1-2,4-5H2,(H,15,16) |
| InChIKey | ALGDKGPTHVIWJW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one (CID 84735172) is 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one is O=C1NC(C2CCCC2)c2c(F)cccc21.
What is the InChIKey of 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one?
The InChIKey is ALGDKGPTHVIWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO/c14-10-7-3-6-9-11(10)12(15-13(9)16)8-4-1-2-5-8/h3,6-8,12H,1-2,4-5H2,(H,15,16).
What are the key properties of 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one?
3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one has a molecular weight of 219.26 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-4-fluoro-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 84735172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).