About 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea
1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea (PubChem CID 847357) has the molecular formula C10H13N5S
and a molecular weight of 235.32 g/mol. Its IUPAC name is 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea.
Molecular Properties
| Compound Name | 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea |
| PubChem CID | 847357 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea |
| SMILES | Cc1cc(C)nc(N(C#N)C(=S)N(C)C)n1 |
| InChI | InChI=1S/C10H13N5S/c1-7-5-8(2)13-9(12-7)15(6-11)10(16)14(3)4/h5H,1-4H3 |
| InChIKey | YODZEACMIBRQDA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea?
The IUPAC name of 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea (CID 847357) is 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea.
What is the SMILES notation for 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea?
The canonical SMILES for 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea is Cc1cc(C)nc(N(C#N)C(=S)N(C)C)n1.
What is the InChIKey of 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea?
The InChIKey is YODZEACMIBRQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5S/c1-7-5-8(2)13-9(12-7)15(6-11)10(16)14(3)4/h5H,1-4H3.
What are the key properties of 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea?
1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea has a molecular weight of 235.32 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-1-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylthiourea is sourced from PubChem (CID 847357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).