1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid

C10H12F2N2O2 — CID 84736126

IUPAC1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(C2CCC(F)(F)CC2)c1
InChIInChI=1S/C10H12F2N2O2/c11-10(12)3-1-8(2-4-10)14-6-7(5-13-14)9(15)16/h5-6,8H,1-4H2,(H,15,16)
InChIKeyICKLIWNGCYYAOO-UHFFFAOYSA-N
MW230.21 g/mol
LogP2.33
Rot. Bonds2

About 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid

1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid (PubChem CID 84736126) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid
PubChem CID84736126
Molecular FormulaC10H12F2N2O2
Molecular Weight230.21 g/mol
Exact Mass230.09
IUPAC Name1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(C2CCC(F)(F)CC2)c1
InChIInChI=1S/C10H12F2N2O2/c11-10(12)3-1-8(2-4-10)14-6-7(5-13-14)9(15)16/h5-6,8H,1-4H2,(H,15,16)
InChIKeyICKLIWNGCYYAOO-UHFFFAOYSA-N
XLogP2.33
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.21
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid?
The IUPAC name of 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid (CID 84736126) is 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid is O=C(O)c1cnn(C2CCC(F)(F)CC2)c1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid?
The InChIKey is ICKLIWNGCYYAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O2/c11-10(12)3-1-8(2-4-10)14-6-7(5-13-14)9(15)16/h5-6,8H,1-4H2,(H,15,16).
What are the key properties of 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid?
1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid has a molecular weight of 230.21 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 84736126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).