6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid

C11H10N2O2S — CID 84736468

IUPAC6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid
SMILESCc1nc(-c2cccc(C(=O)O)n2)c(C)s1
InChIInChI=1S/C11H10N2O2S/c1-6-10(12-7(2)16-6)8-4-3-5-9(13-8)11(14)15/h3-5H,1-2H3,(H,14,15)
InChIKeyRYJILFDJXNJONI-UHFFFAOYSA-N
MW234.28 g/mol
LogP2.52
Rot. Bonds2

About 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid

6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid (PubChem CID 84736468) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid
PubChem CID84736468
Molecular FormulaC11H10N2O2S
Molecular Weight234.28 g/mol
Exact Mass234.05
IUPAC Name6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid
SMILESCc1nc(-c2cccc(C(=O)O)n2)c(C)s1
InChIInChI=1S/C11H10N2O2S/c1-6-10(12-7(2)16-6)8-4-3-5-9(13-8)11(14)15/h3-5H,1-2H3,(H,14,15)
InChIKeyRYJILFDJXNJONI-UHFFFAOYSA-N
XLogP2.52
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.28
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid (CID 84736468) is 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid is Cc1nc(-c2cccc(C(=O)O)n2)c(C)s1.
What is the InChIKey of 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid?
The InChIKey is RYJILFDJXNJONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-6-10(12-7(2)16-6)8-4-3-5-9(13-8)11(14)15/h3-5H,1-2H3,(H,14,15).
What are the key properties of 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid?
6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid has a molecular weight of 234.28 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid is sourced from PubChem (CID 84736468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).