C17H18N4S — CID 847366
3-[(2,5-dimethylanilino)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 847366) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 3-[(2,5-dimethylanilino)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2,5-dimethylanilino)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 847366 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-[(2,5-dimethylanilino)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(C)c(NCc2n[nH]c(=S)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C17H18N4S/c1-12-8-9-13(2)15(10-12)18-11-16-19-20-17(22)21(16)14-6-4-3-5-7-14/h3-10,18H,11H2,1-2H3,(H,20,22) |
| InChIKey | PYTKFYXRSIHZPA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|