C11H16BrN — CID 84737080
3-(2-bromo-6-methylphenyl)-N-methylpropan-1-amine (PubChem CID 84737080) has the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. Its IUPAC name is 3-(2-bromo-6-methylphenyl)-N-methylpropan-1-amine.
| Compound Name | 3-(2-bromo-6-methylphenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 84737080 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 3-(2-bromo-6-methylphenyl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1c(C)cccc1Br |
| InChI | InChI=1S/C11H16BrN/c1-9-5-3-7-11(12)10(9)6-4-8-13-2/h3,5,7,13H,4,6,8H2,1-2H3 |
| InChIKey | KDGWHXYRTBXGLE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|