About 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole
7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole (PubChem CID 84737224) has the molecular formula C15H14ClN
and a molecular weight of 243.74 g/mol. Its IUPAC name is 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole |
| PubChem CID | 84737224 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole |
| SMILES | Cc1cccc(C2NCc3cccc(Cl)c32)c1 |
| InChI | InChI=1S/C15H14ClN/c1-10-4-2-5-11(8-10)15-14-12(9-17-15)6-3-7-13(14)16/h2-8,15,17H,9H2,1H3 |
| InChIKey | MRKRATWBEBKPKI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole?
The IUPAC name of 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole (CID 84737224) is 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole?
The canonical SMILES for 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole is Cc1cccc(C2NCc3cccc(Cl)c32)c1.
What is the InChIKey of 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole?
The InChIKey is MRKRATWBEBKPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN/c1-10-4-2-5-11(8-10)15-14-12(9-17-15)6-3-7-13(14)16/h2-8,15,17H,9H2,1H3.
What are the key properties of 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole?
7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole has a molecular weight of 243.74 g/mol, XLogP of 3.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-(3-methylphenyl)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 84737224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).