C9H8BrF3O — CID 84738641
1-bromo-4-(2,2,2-trifluoro-1-methoxyethyl)benzene (PubChem CID 84738641) has the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. Its IUPAC name is 1-bromo-4-(2,2,2-trifluoro-1-methoxyethyl)benzene.
| Compound Name | 1-bromo-4-(2,2,2-trifluoro-1-methoxyethyl)benzene |
|---|---|
| PubChem CID | 84738641 |
| Molecular Formula | C9H8BrF3O |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 1-bromo-4-(2,2,2-trifluoro-1-methoxyethyl)benzene |
| SMILES | COC(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF3O/c1-14-8(9(11,12)13)6-2-4-7(10)5-3-6/h2-5,8H,1H3 |
| InChIKey | VPKDJZKQUYDINR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |