About 5-fluoro-2,3-dihydro-1H-indol-3-amine
5-fluoro-2,3-dihydro-1H-indol-3-amine (PubChem CID 84739506) has the molecular formula C8H9FN2
and a molecular weight of 152.17 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1H-indol-3-amine.
Molecular Properties
| Compound Name | 5-fluoro-2,3-dihydro-1H-indol-3-amine |
| PubChem CID | 84739506 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5-fluoro-2,3-dihydro-1H-indol-3-amine |
| SMILES | NC1CNc2ccc(F)cc21 |
| InChI | InChI=1S/C8H9FN2/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3,7,11H,4,10H2 |
| InChIKey | RAKYOWDVVMUXOS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,3-dihydro-1H-indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dihydro-1H-indol-3-amine?
The IUPAC name of 5-fluoro-2,3-dihydro-1H-indol-3-amine (CID 84739506) is 5-fluoro-2,3-dihydro-1H-indol-3-amine.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1H-indol-3-amine?
The canonical SMILES for 5-fluoro-2,3-dihydro-1H-indol-3-amine is NC1CNc2ccc(F)cc21.
What is the InChIKey of 5-fluoro-2,3-dihydro-1H-indol-3-amine?
The InChIKey is RAKYOWDVVMUXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3,7,11H,4,10H2.
What are the key properties of 5-fluoro-2,3-dihydro-1H-indol-3-amine?
5-fluoro-2,3-dihydro-1H-indol-3-amine has a molecular weight of 152.17 g/mol, XLogP of 1.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1H-indol-3-amine is sourced from PubChem (CID 84739506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).