C12H11NS — CID 84739761
2,4,6-trimethyl-1-benzothiophene-3-carbonitrile (PubChem CID 84739761) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-benzothiophene-3-carbonitrile.
| Compound Name | 2,4,6-trimethyl-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 84739761 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2,4,6-trimethyl-1-benzothiophene-3-carbonitrile |
| SMILES | Cc1cc(C)c2c(C#N)c(C)sc2c1 |
| InChI | InChI=1S/C12H11NS/c1-7-4-8(2)12-10(6-13)9(3)14-11(12)5-7/h4-5H,1-3H3 |
| InChIKey | WGGZBRBOZYRLNN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |