About 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile
2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile (PubChem CID 84739885) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile |
| PubChem CID | 84739885 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile |
| SMILES | CCN(CC)C(C#N)c1cnc(C)n1C |
| InChI | InChI=1S/C11H18N4/c1-5-15(6-2)10(7-12)11-8-13-9(3)14(11)4/h8,10H,5-6H2,1-4H3 |
| InChIKey | YFGOYMOOVLDBIC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile?
The IUPAC name of 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile (CID 84739885) is 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile.
What is the SMILES notation for 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile?
The canonical SMILES for 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile is CCN(CC)C(C#N)c1cnc(C)n1C.
What is the InChIKey of 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile?
The InChIKey is YFGOYMOOVLDBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-5-15(6-2)10(7-12)11-8-13-9(3)14(11)4/h8,10H,5-6H2,1-4H3.
What are the key properties of 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile?
2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile has a molecular weight of 206.29 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-2-(2,3-dimethylimidazol-4-yl)acetonitrile is sourced from PubChem (CID 84739885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).