About N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine
N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine (PubChem CID 84739945) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine |
| PubChem CID | 84739945 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)C(CNC)c1nc[nH]c1C |
| InChI | InChI=1S/C11H22N4/c1-5-15(6-2)10(7-12-4)11-9(3)13-8-14-11/h8,10,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | MOYHUHAHHFYTJV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine?
The IUPAC name of N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine (CID 84739945) is N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine?
The canonical SMILES for N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine is CCN(CC)C(CNC)c1nc[nH]c1C.
What is the InChIKey of N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine?
The InChIKey is MOYHUHAHHFYTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4/c1-5-15(6-2)10(7-12-4)11-9(3)13-8-14-11/h8,10,12H,5-7H2,1-4H3,(H,13,14).
What are the key properties of N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine?
N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine has a molecular weight of 210.32 g/mol, XLogP of 1.32, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-N'-methyl-1-(5-methyl-1H-imidazol-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 84739945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).