About 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one
8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one (PubChem CID 84739991) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one.
Molecular Properties
| Compound Name | 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one |
| PubChem CID | 84739991 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one |
| SMILES | Cc1cccc2c3c(n(C)c12)CCCC3=O |
| InChI | InChI=1S/C14H15NO/c1-9-5-3-6-10-13-11(15(2)14(9)10)7-4-8-12(13)16/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | UIJMHKYHMUUWOF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one?
The IUPAC name of 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one (CID 84739991) is 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one.
What is the SMILES notation for 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one?
The canonical SMILES for 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one is Cc1cccc2c3c(n(C)c12)CCCC3=O.
What is the InChIKey of 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one?
The InChIKey is UIJMHKYHMUUWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c1-9-5-3-6-10-13-11(15(2)14(9)10)7-4-8-12(13)16/h3,5-6H,4,7-8H2,1-2H3.
What are the key properties of 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one?
8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one has a molecular weight of 213.28 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dimethyl-2,3-dihydro-1H-carbazol-4-one is sourced from PubChem (CID 84739991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).