C13H17N3 — CID 84740105
5-methyl-3-piperidin-3-ylimidazo[1,5-a]pyridine (PubChem CID 84740105) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-methyl-3-piperidin-3-ylimidazo[1,5-a]pyridine.
| Compound Name | 5-methyl-3-piperidin-3-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 84740105 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 5-methyl-3-piperidin-3-ylimidazo[1,5-a]pyridine |
| SMILES | Cc1cccc2cnc(C3CCCNC3)n12 |
| InChI | InChI=1S/C13H17N3/c1-10-4-2-6-12-9-15-13(16(10)12)11-5-3-7-14-8-11/h2,4,6,9,11,14H,3,5,7-8H2,1H3 |
| InChIKey | AFZYPDPFLCMVQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |