C14H17FN2 — CID 84740959
8-fluoro-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 84740959) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 8-fluoro-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 8-fluoro-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 84740959 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 8-fluoro-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | Cn1c2c(c3cccc(F)c31)CC(C)(C)NC2 |
| InChI | InChI=1S/C14H17FN2/c1-14(2)7-10-9-5-4-6-11(15)13(9)17(3)12(10)8-16-14/h4-6,16H,7-8H2,1-3H3 |
| InChIKey | QUDGIEZXKQMDLC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|