C14H17FN2 — CID 84740967
1-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine (PubChem CID 84740967) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine.
| Compound Name | 1-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 84740967 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 1-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine |
| SMILES | CNCC1CCCc2[nH]c3cc(F)ccc3c21 |
| InChI | InChI=1S/C14H17FN2/c1-16-8-9-3-2-4-12-14(9)11-6-5-10(15)7-13(11)17-12/h5-7,9,16-17H,2-4,8H2,1H3 |
| InChIKey | JZORTKQHRYIZJE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|