C13H12ClNO — CID 84741031
7-chloro-8-methyl-1,2,3,9-tetrahydrocarbazol-4-one (PubChem CID 84741031) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 7-chloro-8-methyl-1,2,3,9-tetrahydrocarbazol-4-one.
| Compound Name | 7-chloro-8-methyl-1,2,3,9-tetrahydrocarbazol-4-one |
|---|---|
| PubChem CID | 84741031 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 7-chloro-8-methyl-1,2,3,9-tetrahydrocarbazol-4-one |
| SMILES | Cc1c(Cl)ccc2c3c([nH]c12)CCCC3=O |
| InChI | InChI=1S/C13H12ClNO/c1-7-9(14)6-5-8-12-10(15-13(7)8)3-2-4-11(12)16/h5-6,15H,2-4H2,1H3 |
| InChIKey | JOSPPGIQPPRJQQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |