C10H8Cl2N2O — CID 847413
4,4-dichloro-5-methyl-2-phenylpyrazol-3-one (PubChem CID 847413) has the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. Its IUPAC name is 4,4-dichloro-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4,4-dichloro-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 847413 |
| Molecular Formula | C10H8Cl2N2O |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 4,4-dichloro-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C10H8Cl2N2O/c1-7-10(11,12)9(15)14(13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | UJFNZIVFAMOQEI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|