C16H22N2 — CID 84741422
N-methyl-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-4-amine (PubChem CID 84741422) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-methyl-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-4-amine.
| Compound Name | N-methyl-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-4-amine |
|---|---|
| PubChem CID | 84741422 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-methyl-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-4-amine |
| SMILES | CNC1CCCc2[nH]c3ccc(C(C)C)cc3c21 |
| InChI | InChI=1S/C16H22N2/c1-10(2)11-7-8-13-12(9-11)16-14(17-3)5-4-6-15(16)18-13/h7-10,14,17-18H,4-6H2,1-3H3 |
| InChIKey | NKTHECYAEGMBLM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|