C16H22N2 — CID 84741438
3,3,5,6,8-pentamethyl-2,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 84741438) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3,3,5,6,8-pentamethyl-2,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 3,3,5,6,8-pentamethyl-2,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 84741438 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3,3,5,6,8-pentamethyl-2,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1cc(C)c2c(c1)c1c(n2C)CC(C)(C)NC1 |
| InChI | InChI=1S/C16H22N2/c1-10-6-11(2)15-12(7-10)13-9-17-16(3,4)8-14(13)18(15)5/h6-7,17H,8-9H2,1-5H3 |
| InChIKey | BFMXXSFDEPCBKT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|