About 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine
2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine (PubChem CID 84741765) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine |
| PubChem CID | 84741765 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine |
| SMILES | COc1ccc2cc3n(c2c1)CCN(CCN)C3 |
| InChI | InChI=1S/C14H19N3O/c1-18-13-3-2-11-8-12-10-16(5-4-15)6-7-17(12)14(11)9-13/h2-3,8-9H,4-7,10,15H2,1H3 |
| InChIKey | CMUDZMXHPBVXKC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine?
The IUPAC name of 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine (CID 84741765) is 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine.
What is the SMILES notation for 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine?
The canonical SMILES for 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine is COc1ccc2cc3n(c2c1)CCN(CCN)C3.
What is the InChIKey of 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine?
The InChIKey is CMUDZMXHPBVXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-18-13-3-2-11-8-12-10-16(5-4-15)6-7-17(12)14(11)9-13/h2-3,8-9H,4-7,10,15H2,1H3.
What are the key properties of 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine?
2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine has a molecular weight of 245.33 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)ethanamine is sourced from PubChem (CID 84741765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).