About 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine
3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine (PubChem CID 84742588) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine |
| PubChem CID | 84742588 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine |
| SMILES | COc1cccc2cc3n(c12)CCN(CCCN)C3 |
| InChI | InChI=1S/C15H21N3O/c1-19-14-5-2-4-12-10-13-11-17(7-3-6-16)8-9-18(13)15(12)14/h2,4-5,10H,3,6-9,11,16H2,1H3 |
| InChIKey | UUQPOSDRAZWWJU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine?
The IUPAC name of 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine (CID 84742588) is 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine.
What is the SMILES notation for 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine?
The canonical SMILES for 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine is COc1cccc2cc3n(c12)CCN(CCCN)C3.
What is the InChIKey of 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine?
The InChIKey is UUQPOSDRAZWWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-19-14-5-2-4-12-10-13-11-17(7-3-6-16)8-9-18(13)15(12)14/h2,4-5,10H,3,6-9,11,16H2,1H3.
What are the key properties of 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine?
3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine has a molecular weight of 259.35 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methoxy-3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)propan-1-amine is sourced from PubChem (CID 84742588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).