C15H18O2S — CID 84742718
2-(5-tert-butyl-3-methyl-1-benzothiophen-2-yl)acetic acid (PubChem CID 84742718) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-(5-tert-butyl-3-methyl-1-benzothiophen-2-yl)acetic acid.
| Compound Name | 2-(5-tert-butyl-3-methyl-1-benzothiophen-2-yl)acetic acid |
|---|---|
| PubChem CID | 84742718 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-(5-tert-butyl-3-methyl-1-benzothiophen-2-yl)acetic acid |
| SMILES | Cc1c(CC(=O)O)sc2ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C15H18O2S/c1-9-11-7-10(15(2,3)4)5-6-12(11)18-13(9)8-14(16)17/h5-7H,8H2,1-4H3,(H,16,17) |
| InChIKey | AVSBLNQPDWZQDE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |