C15H19ClN2 — CID 84742733
1-(7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine (PubChem CID 84742733) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 1-(7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine.
| Compound Name | 1-(7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 84742733 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-yl)-N-methylmethanamine |
| SMILES | CNCC1CCCc2[nH]c3c(C)c(Cl)ccc3c21 |
| InChI | InChI=1S/C15H19ClN2/c1-9-12(16)7-6-11-14-10(8-17-2)4-3-5-13(14)18-15(9)11/h6-7,10,17-18H,3-5,8H2,1-2H3 |
| InChIKey | UWDUDIJPPYXLET-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|