About 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine
5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine (PubChem CID 84743031) has the molecular formula C16H20N4
and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine |
| PubChem CID | 84743031 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine |
| SMILES | Cc1c(-c2cc(N)n[nH]2)c2cc(C(C)C)ccc2n1C |
| InChI | InChI=1S/C16H20N4/c1-9(2)11-5-6-14-12(7-11)16(10(3)20(14)4)13-8-15(17)19-18-13/h5-9H,1-4H3,(H3,17,18,19) |
| InChIKey | MDMSVWCRXZQZFV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine (CID 84743031) is 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine is Cc1c(-c2cc(N)n[nH]2)c2cc(C(C)C)ccc2n1C.
What is the InChIKey of 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine?
The InChIKey is MDMSVWCRXZQZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4/c1-9(2)11-5-6-14-12(7-11)16(10(3)20(14)4)13-8-15(17)19-18-13/h5-9H,1-4H3,(H3,17,18,19).
What are the key properties of 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine?
5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine has a molecular weight of 268.36 g/mol, XLogP of 3.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dimethyl-5-propan-2-ylindol-3-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 84743031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).