C18H26N2 — CID 84743131
8-tert-butyl-3,3,5-trimethyl-2,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 84743131) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 8-tert-butyl-3,3,5-trimethyl-2,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-tert-butyl-3,3,5-trimethyl-2,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 84743131 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 8-tert-butyl-3,3,5-trimethyl-2,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cn1c2c(c3cc(C(C)(C)C)ccc31)CNC(C)(C)C2 |
| InChI | InChI=1S/C18H26N2/c1-17(2,3)12-7-8-15-13(9-12)14-11-19-18(4,5)10-16(14)20(15)6/h7-9,19H,10-11H2,1-6H3 |
| InChIKey | IETHFNZEDIAOOL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|