About 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine
1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine (PubChem CID 84743375) has the molecular formula C14H19ClN4
and a molecular weight of 278.79 g/mol. Its IUPAC name is 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 84743375 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)C(CN)c1c(Cl)nc(-c2ccccc2)n1C |
| InChI | InChI=1S/C14H19ClN4/c1-18(2)11(9-16)12-13(15)17-14(19(12)3)10-7-5-4-6-8-10/h4-8,11H,9,16H2,1-3H3 |
| InChIKey | PCLGLZWLDZQQPO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine?
The IUPAC name of 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine (CID 84743375) is 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine is CN(C)C(CN)c1c(Cl)nc(-c2ccccc2)n1C.
What is the InChIKey of 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine?
The InChIKey is PCLGLZWLDZQQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN4/c1-18(2)11(9-16)12-13(15)17-14(19(12)3)10-7-5-4-6-8-10/h4-8,11H,9,16H2,1-3H3.
What are the key properties of 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine?
1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine has a molecular weight of 278.79 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 84743375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).